C18H17N7O2 — CID 166631254
(1R,9S)-13-(8-amino-3-methyl-[1,2,4]triazolo[4,3-b]pyridazine-6-carbonyl)-11,13-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-one (PubChem CID 166631254) has the molecular formula C18H17N7O2 and a molecular weight of 363.38 g/mol. Its IUPAC name is (1R,9S)-13-(8-amino-3-methyl-[1,2,4]triazolo[4,3-b]pyridazine-6-carbonyl)-11,13-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-one.
| Compound Name | (1R,9S)-13-(8-amino-3-methyl-[1,2,4]triazolo[4,3-b]pyridazine-6-carbonyl)-11,13-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-one |
|---|---|
| PubChem CID | 166631254 |
| Molecular Formula | C18H17N7O2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (1R,9S)-13-(8-amino-3-methyl-[1,2,4]triazolo[4,3-b]pyridazine-6-carbonyl)-11,13-diazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-one |
| SMILES | Cc1nnc2c(N)cc(C(=O)N3[C@H]4Cc5ccccc5[C@@H]3CNC4=O)nn12 |
| InChI | InChI=1S/C18H17N7O2/c1-9-21-22-16-12(19)7-13(23-25(9)16)18(27)24-14-6-10-4-2-3-5-11(10)15(24)8-20-17(14)26/h2-5,7,14-15H,6,8,19H2,1H3,(H,20,26)/t14-,15-/m0/s1 |
| InChIKey | RNMUWJXNHYJGEP-GJZGRUSLSA-N |
| XLogP | 0.25 |
| TPSA | 118.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |