C31H34N4O5 — CID 166631273
2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenoxy]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 166631273) has the molecular formula C31H34N4O5 and a molecular weight of 542.64 g/mol. Its IUPAC name is 2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenoxy]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenoxy]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 166631273 |
| Molecular Formula | C31H34N4O5 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 2-[4-(5,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)-2,6-dimethylphenoxy]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | COc1cc(OC)c2c(=O)[nH]c(-c3cc(C)c(OCC(=O)Nc4ccc(N5CCCCC5)cc4)c(C)c3)nc2c1 |
| InChI | InChI=1S/C31H34N4O5/c1-19-14-21(30-33-25-16-24(38-3)17-26(39-4)28(25)31(37)34-30)15-20(2)29(19)40-18-27(36)32-22-8-10-23(11-9-22)35-12-6-5-7-13-35/h8-11,14-17H,5-7,12-13,18H2,1-4H3,(H,32,36)(H,33,34,37) |
| InChIKey | JFFLKKRAIXOHMF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|