C27H29N7O3S2 — CID 166631346
4-[2-[[6-[[4-(3-hydroxypropylamino)-6-methylquinazolin-2-yl]amino]-1,3-benzothiazol-2-yl]amino]ethyl]benzenesulfonamide (PubChem CID 166631346) has the molecular formula C27H29N7O3S2 and a molecular weight of 563.71 g/mol. Its IUPAC name is 4-[2-[[6-[[4-(3-hydroxypropylamino)-6-methylquinazolin-2-yl]amino]-1,3-benzothiazol-2-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[6-[[4-(3-hydroxypropylamino)-6-methylquinazolin-2-yl]amino]-1,3-benzothiazol-2-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 166631346 |
| Molecular Formula | C27H29N7O3S2 |
| Molecular Weight | 563.71 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | 4-[2-[[6-[[4-(3-hydroxypropylamino)-6-methylquinazolin-2-yl]amino]-1,3-benzothiazol-2-yl]amino]ethyl]benzenesulfonamide |
| SMILES | Cc1ccc2nc(Nc3ccc4nc(NCCc5ccc(S(N)(=O)=O)cc5)sc4c3)nc(NCCCO)c2c1 |
| InChI | InChI=1S/C27H29N7O3S2/c1-17-3-9-22-21(15-17)25(29-12-2-14-35)34-26(32-22)31-19-6-10-23-24(16-19)38-27(33-23)30-13-11-18-4-7-20(8-5-18)39(28,36)37/h3-10,15-16,35H,2,11-14H2,1H3,(H,30,33)(H2,28,36,37)(H2,29,31,32,34) |
| InChIKey | VZNYHMHMAMHNCN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 155.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.71 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|