About (6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methanol
(6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methanol (PubChem CID 166631546) has the molecular formula C7H5ClN2OS
and a molecular weight of 200.65 g/mol. Its IUPAC name is (6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methanol.
Molecular Properties
| Compound Name | (6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methanol |
| PubChem CID | 166631546 |
| Molecular Formula | C7H5ClN2OS |
| Molecular Weight | 200.65 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | (6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methanol |
| SMILES | OCc1nc2cc(Cl)cnc2s1 |
| InChI | InChI=1S/C7H5ClN2OS/c8-4-1-5-7(9-2-4)12-6(3-11)10-5/h1-2,11H,3H2 |
| InChIKey | NFXOSZORXDSUPK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.65 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methanol?
The IUPAC name of (6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methanol (CID 166631546) is (6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methanol.
What is the SMILES notation for (6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methanol?
The canonical SMILES for (6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methanol is OCc1nc2cc(Cl)cnc2s1.
What is the InChIKey of (6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methanol?
The InChIKey is NFXOSZORXDSUPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2OS/c8-4-1-5-7(9-2-4)12-6(3-11)10-5/h1-2,11H,3H2.
What are the key properties of (6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methanol?
(6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methanol has a molecular weight of 200.65 g/mol, XLogP of 1.84, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methanol is sourced from PubChem (CID 166631546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).