C40H44N4O5 — CID 166631596
N-[(2S)-1-[[(E)-4-(dibenzylamino)-4-oxobut-2-enyl]amino]-4-methyl-1-oxopentan-2-yl]-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxamide (PubChem CID 166631596) has the molecular formula C40H44N4O5 and a molecular weight of 660.82 g/mol. Its IUPAC name is N-[(2S)-1-[[(E)-4-(dibenzylamino)-4-oxobut-2-enyl]amino]-4-methyl-1-oxopentan-2-yl]-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxamide.
| Compound Name | N-[(2S)-1-[[(E)-4-(dibenzylamino)-4-oxobut-2-enyl]amino]-4-methyl-1-oxopentan-2-yl]-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 166631596 |
| Molecular Formula | C40H44N4O5 |
| Molecular Weight | 660.82 g/mol |
| Exact Mass | 660.33 |
| IUPAC Name | N-[(2S)-1-[[(E)-4-(dibenzylamino)-4-oxobut-2-enyl]amino]-4-methyl-1-oxopentan-2-yl]-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)c1cc2cc3c4c(c2oc1=O)CCCN4CCC3)C(=O)NC/C=C/C(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C40H44N4O5/c1-27(2)22-34(39(47)41-19-9-18-35(45)44(25-28-12-5-3-6-13-28)26-29-14-7-4-8-15-29)42-38(46)33-24-31-23-30-16-10-20-43-21-11-17-32(36(30)43)37(31)49-40(33)48/h3-9,12-15,18,23-24,27,34H,10-11,16-17,19-22,25-26H2,1-2H3,(H,41,47)(H,42,46)/b18-9+/t34-/m0/s1 |
| InChIKey | MSPNBZCFDRBHBJ-MVUPDZOFSA-N |
| XLogP | 5.54 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.82 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|