C24H26N2O4 — CID 166631703
2-[[6-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]-2-methoxy-3-pyridinyl]methylamino]ethanol (PubChem CID 166631703) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 2-[[6-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]-2-methoxy-3-pyridinyl]methylamino]ethanol.
| Compound Name | 2-[[6-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]-2-methoxy-3-pyridinyl]methylamino]ethanol |
|---|---|
| PubChem CID | 166631703 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 2-[[6-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]-2-methoxy-3-pyridinyl]methylamino]ethanol |
| SMILES | COc1nc(-c2cccc(-c3ccc4c(c3)OCCO4)c2C)ccc1CNCCO |
| InChI | InChI=1S/C24H26N2O4/c1-16-19(17-7-9-22-23(14-17)30-13-12-29-22)4-3-5-20(16)21-8-6-18(15-25-10-11-27)24(26-21)28-2/h3-9,14,25,27H,10-13,15H2,1-2H3 |
| InChIKey | JDBUMVVEIURCQC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|