About 4-[[4-[2,6-dimethyl-4-(5-methylthiophen-2-yl)anilino]pyrimidin-2-yl]amino]benzonitrile
4-[[4-[2,6-dimethyl-4-(5-methylthiophen-2-yl)anilino]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 166631925) has the molecular formula C24H21N5S
and a molecular weight of 411.53 g/mol. Its IUPAC name is 4-[[4-[2,6-dimethyl-4-(5-methylthiophen-2-yl)anilino]pyrimidin-2-yl]amino]benzonitrile.
Molecular Properties
| Compound Name | 4-[[4-[2,6-dimethyl-4-(5-methylthiophen-2-yl)anilino]pyrimidin-2-yl]amino]benzonitrile |
| PubChem CID | 166631925 |
| Molecular Formula | C24H21N5S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 4-[[4-[2,6-dimethyl-4-(5-methylthiophen-2-yl)anilino]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | Cc1ccc(-c2cc(C)c(Nc3ccnc(Nc4ccc(C#N)cc4)n3)c(C)c2)s1 |
| InChI | InChI=1S/C24H21N5S/c1-15-12-19(21-9-4-17(3)30-21)13-16(2)23(15)28-22-10-11-26-24(29-22)27-20-7-5-18(14-25)6-8-20/h4-13H,1-3H3,(H2,26,27,28,29) |
| InChIKey | RCJGIRHVUGADTP-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[4-[2,6-dimethyl-4-(5-methylthiophen-2-yl)anilino]pyrimidin-2-yl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-[2,6-dimethyl-4-(5-methylthiophen-2-yl)anilino]pyrimidin-2-yl]amino]benzonitrile?
The IUPAC name of 4-[[4-[2,6-dimethyl-4-(5-methylthiophen-2-yl)anilino]pyrimidin-2-yl]amino]benzonitrile (CID 166631925) is 4-[[4-[2,6-dimethyl-4-(5-methylthiophen-2-yl)anilino]pyrimidin-2-yl]amino]benzonitrile.
What is the SMILES notation for 4-[[4-[2,6-dimethyl-4-(5-methylthiophen-2-yl)anilino]pyrimidin-2-yl]amino]benzonitrile?
The canonical SMILES for 4-[[4-[2,6-dimethyl-4-(5-methylthiophen-2-yl)anilino]pyrimidin-2-yl]amino]benzonitrile is Cc1ccc(-c2cc(C)c(Nc3ccnc(Nc4ccc(C#N)cc4)n3)c(C)c2)s1.
What is the InChIKey of 4-[[4-[2,6-dimethyl-4-(5-methylthiophen-2-yl)anilino]pyrimidin-2-yl]amino]benzonitrile?
The InChIKey is RCJGIRHVUGADTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N5S/c1-15-12-19(21-9-4-17(3)30-21)13-16(2)23(15)28-22-10-11-26-24(29-22)27-20-7-5-18(14-25)6-8-20/h4-13H,1-3H3,(H2,26,27,28,29).
What are the key properties of 4-[[4-[2,6-dimethyl-4-(5-methylthiophen-2-yl)anilino]pyrimidin-2-yl]amino]benzonitrile?
4-[[4-[2,6-dimethyl-4-(5-methylthiophen-2-yl)anilino]pyrimidin-2-yl]amino]benzonitrile has a molecular weight of 411.53 g/mol, XLogP of 6.49, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-[2,6-dimethyl-4-(5-methylthiophen-2-yl)anilino]pyrimidin-2-yl]amino]benzonitrile is sourced from PubChem (CID 166631925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).