C27H26N4O4 — CID 166632070
7-formyl-N-[5-[2-(3-methoxyphenyl)ethynyl]-4-propan-2-yloxy-2-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 166632070) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is 7-formyl-N-[5-[2-(3-methoxyphenyl)ethynyl]-4-propan-2-yloxy-2-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | 7-formyl-N-[5-[2-(3-methoxyphenyl)ethynyl]-4-propan-2-yloxy-2-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 166632070 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 7-formyl-N-[5-[2-(3-methoxyphenyl)ethynyl]-4-propan-2-yloxy-2-pyridinyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | COc1cccc(C#Cc2cnc(NC(=O)N3CCCc4ccc(C=O)nc43)cc2OC(C)C)c1 |
| InChI | InChI=1S/C27H26N4O4/c1-18(2)35-24-15-25(28-16-21(24)10-9-19-6-4-8-23(14-19)34-3)30-27(33)31-13-5-7-20-11-12-22(17-32)29-26(20)31/h4,6,8,11-12,14-18H,5,7,13H2,1-3H3,(H,28,30,33) |
| InChIKey | VBFZMYKJVWSVTO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|