C41H44N4O4 — CID 166632136
N-[5-[[(E)-3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoyl]amino]pentyl]-3-(6-methoxy-1H-benzimidazol-2-yl)propanamide (PubChem CID 166632136) has the molecular formula C41H44N4O4 and a molecular weight of 656.83 g/mol. Its IUPAC name is N-[5-[[(E)-3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoyl]amino]pentyl]-3-(6-methoxy-1H-benzimidazol-2-yl)propanamide.
| Compound Name | N-[5-[[(E)-3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoyl]amino]pentyl]-3-(6-methoxy-1H-benzimidazol-2-yl)propanamide |
|---|---|
| PubChem CID | 166632136 |
| Molecular Formula | C41H44N4O4 |
| Molecular Weight | 656.83 g/mol |
| Exact Mass | 656.34 |
| IUPAC Name | N-[5-[[(E)-3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoyl]amino]pentyl]-3-(6-methoxy-1H-benzimidazol-2-yl)propanamide |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(/C=C/C(=O)NCCCCCNC(=O)CCc2nc3ccc(OC)cc3[nH]2)cc1)c1ccccc1 |
| InChI | InChI=1S/C41H44N4O4/c1-3-35(30-10-6-4-7-11-30)41(32-17-19-33(46)20-18-32)31-15-12-29(13-16-31)14-24-39(47)42-26-8-5-9-27-43-40(48)25-23-38-44-36-22-21-34(49-2)28-37(36)45-38/h4,6-7,10-22,24,28,46H,3,5,8-9,23,25-27H2,1-2H3,(H,42,47)(H,43,48)(H,44,45)/b24-14+,41-35? |
| InChIKey | GLRROHFNBXFFLG-MBYNOQGMSA-N |
| XLogP | 7.69 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.83 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|