C27H18BrN3O2 — CID 166632324
4-[(1R)-2-(5-bromo-1-benzofuran-2-carbonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]benzonitrile (PubChem CID 166632324) has the molecular formula C27H18BrN3O2 and a molecular weight of 496.36 g/mol. Its IUPAC name is 4-[(1R)-2-(5-bromo-1-benzofuran-2-carbonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]benzonitrile.
| Compound Name | 4-[(1R)-2-(5-bromo-1-benzofuran-2-carbonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 166632324 |
| Molecular Formula | C27H18BrN3O2 |
| Molecular Weight | 496.36 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | 4-[(1R)-2-(5-bromo-1-benzofuran-2-carbonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]benzonitrile |
| SMILES | N#Cc1ccc([C@@H]2c3[nH]c4ccccc4c3CCN2C(=O)c2cc3cc(Br)ccc3o2)cc1 |
| InChI | InChI=1S/C27H18BrN3O2/c28-19-9-10-23-18(13-19)14-24(33-23)27(32)31-12-11-21-20-3-1-2-4-22(20)30-25(21)26(31)17-7-5-16(15-29)6-8-17/h1-10,13-14,26,30H,11-12H2/t26-/m1/s1 |
| InChIKey | MDRUVBGABQQSLX-AREMUKBSSA-N |
| XLogP | 6.34 |
| TPSA | 73.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.36 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|