C38H46Cl2N8O2 — CID 166632331
2-[3-[(2R,5R)-5-[3-(diaminomethylideneamino)propyl]-3,6-dioxo-1,4-bis[(4-phenylphenyl)methyl]piperazin-2-yl]propyl]guanidine;dihydrochloride (PubChem CID 166632331) has the molecular formula C38H46Cl2N8O2 and a molecular weight of 717.75 g/mol. Its IUPAC name is 2-[3-[(2R,5R)-5-[3-(diaminomethylideneamino)propyl]-3,6-dioxo-1,4-bis[(4-phenylphenyl)methyl]piperazin-2-yl]propyl]guanidine;dihydrochloride.
| Compound Name | 2-[3-[(2R,5R)-5-[3-(diaminomethylideneamino)propyl]-3,6-dioxo-1,4-bis[(4-phenylphenyl)methyl]piperazin-2-yl]propyl]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 166632331 |
| Molecular Formula | C38H46Cl2N8O2 |
| Molecular Weight | 717.75 g/mol |
| Exact Mass | 716.31 |
| IUPAC Name | 2-[3-[(2R,5R)-5-[3-(diaminomethylideneamino)propyl]-3,6-dioxo-1,4-bis[(4-phenylphenyl)methyl]piperazin-2-yl]propyl]guanidine;dihydrochloride |
| SMILES | Cl.Cl.NC(N)=NCCC[C@@H]1C(=O)N(Cc2ccc(-c3ccccc3)cc2)[C@H](CCCN=C(N)N)C(=O)N1Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C38H44N8O2.2ClH/c39-37(40)43-23-7-13-33-36(48)46(26-28-17-21-32(22-18-28)30-11-5-2-6-12-30)34(14-8-24-44-38(41)42)35(47)45(33)25-27-15-19-31(20-16-27)29-9-3-1-4-10-29;;/h1-6,9-12,15-22,33-34H,7-8,13-14,23-26H2,(H4,39,40,43)(H4,41,42,44);2*1H/t33-,34-;;/m1../s1 |
| InChIKey | KAZJYCJBNJZNJQ-LRKCTVFQSA-N |
| XLogP | 5.08 |
| TPSA | 169.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.75 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|