C14H13F3N4O4 — CID 166632351
7-methyl-2-nitro-7-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]-5,6-dihydroimidazo[2,1-b][1,3]oxazine (PubChem CID 166632351) has the molecular formula C14H13F3N4O4 and a molecular weight of 358.28 g/mol. Its IUPAC name is 7-methyl-2-nitro-7-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]-5,6-dihydroimidazo[2,1-b][1,3]oxazine.
| Compound Name | 7-methyl-2-nitro-7-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]-5,6-dihydroimidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 166632351 |
| Molecular Formula | C14H13F3N4O4 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 7-methyl-2-nitro-7-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]-5,6-dihydroimidazo[2,1-b][1,3]oxazine |
| SMILES | CC1(COc2ccc(C(F)(F)F)cn2)CCn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C14H13F3N4O4/c1-13(4-5-20-7-10(21(22)23)19-12(20)25-13)8-24-11-3-2-9(6-18-11)14(15,16)17/h2-3,6-7H,4-5,8H2,1H3 |
| InChIKey | IPSCEEDMLVAPAA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 92.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|