C24H38O5 — CID 166632404
2,5,7-trihydroxy-2-[(E)-pentadec-10-enyl]-6,7-dihydro-3H-chromen-4-one (PubChem CID 166632404) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is 2,5,7-trihydroxy-2-[(E)-pentadec-10-enyl]-6,7-dihydro-3H-chromen-4-one.
| Compound Name | 2,5,7-trihydroxy-2-[(E)-pentadec-10-enyl]-6,7-dihydro-3H-chromen-4-one |
|---|---|
| PubChem CID | 166632404 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 2,5,7-trihydroxy-2-[(E)-pentadec-10-enyl]-6,7-dihydro-3H-chromen-4-one |
| SMILES | CCCC/C=C/CCCCCCCCCC1(O)CC(=O)C2=C(O)CC(O)C=C2O1 |
| InChI | InChI=1S/C24H38O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-24(28)18-21(27)23-20(26)16-19(25)17-22(23)29-24/h5-6,17,19,25-26,28H,2-4,7-16,18H2,1H3/b6-5+ |
| InChIKey | BWZGGBYPNWDEHD-AATRIKPKSA-N |
| XLogP | 5.38 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|