C42H60O6 — CID 166632451
8-[2-(1-adamantyl)acetyl]oxyoctyl (E,4S)-4-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]pent-2-enoate (PubChem CID 166632451) has the molecular formula C42H60O6 and a molecular weight of 660.94 g/mol. Its IUPAC name is 8-[2-(1-adamantyl)acetyl]oxyoctyl (E,4S)-4-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]pent-2-enoate.
| Compound Name | 8-[2-(1-adamantyl)acetyl]oxyoctyl (E,4S)-4-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]pent-2-enoate |
|---|---|
| PubChem CID | 166632451 |
| Molecular Formula | C42H60O6 |
| Molecular Weight | 660.94 g/mol |
| Exact Mass | 660.44 |
| IUPAC Name | 8-[2-(1-adamantyl)acetyl]oxyoctyl (E,4S)-4-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]pent-2-enoate |
| SMILES | CC1=CC(=O)[C@H]2/C(C=O)=C\C[C@H]3[C@@H]([C@@H](C)/C=C/C(=O)OCCCCCCCCOC(=O)CC45CC6CC(CC(C6)C4)C5)CC[C@]3(C)C[C@H]12 |
| InChI | InChI=1S/C42H60O6/c1-28(34-14-15-41(3)25-35-29(2)18-37(44)40(35)33(27-43)11-12-36(34)41)10-13-38(45)47-16-8-6-4-5-7-9-17-48-39(46)26-42-22-30-19-31(23-42)21-32(20-30)24-42/h10-11,13,18,27-28,30-32,34-36,40H,4-9,12,14-17,19-26H2,1-3H3/b13-10+,33-11-/t28-,30?,31?,32?,34+,35+,36-,40-,41+,42?/m0/s1 |
| InChIKey | VWYRSVKNHJOHLM-CEVZBYKASA-N |
| XLogP | 8.93 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.94 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|