C25H34O5 — CID 166632474
[(2R,4R,8R,9S,13R)-8-hydroxy-5,5,9-trimethyl-14-methylidene-10,15-dioxo-2-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] 3-methylbut-3-enoate (PubChem CID 166632474) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is [(2R,4R,8R,9S,13R)-8-hydroxy-5,5,9-trimethyl-14-methylidene-10,15-dioxo-2-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] 3-methylbut-3-enoate.
| Compound Name | [(2R,4R,8R,9S,13R)-8-hydroxy-5,5,9-trimethyl-14-methylidene-10,15-dioxo-2-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] 3-methylbut-3-enoate |
|---|---|
| PubChem CID | 166632474 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | [(2R,4R,8R,9S,13R)-8-hydroxy-5,5,9-trimethyl-14-methylidene-10,15-dioxo-2-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] 3-methylbut-3-enoate |
| SMILES | C=C(C)CC(=O)O[C@@H]1C[C@@H]2C(C)(C)CC[C@@H](O)[C@@]2(C)C(=O)CC[C@@H]2C=C1C(=O)C2=C |
| InChI | InChI=1S/C25H34O5/c1-14(2)11-22(28)30-18-13-19-24(4,5)10-9-21(27)25(19,6)20(26)8-7-16-12-17(18)23(29)15(16)3/h12,16,18-19,21,27H,1,3,7-11,13H2,2,4-6H3/t16-,18-,19-,21-,25-/m1/s1 |
| InChIKey | CCXAMMXNKKJFOO-UQPARCOOSA-N |
| XLogP | 4.10 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|