About 1-[[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]methyl]pyrrolidine
1-[[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]methyl]pyrrolidine (PubChem CID 166632665) has the molecular formula C12H17NOS
and a molecular weight of 223.34 g/mol. Its IUPAC name is 1-[[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]methyl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]methyl]pyrrolidine |
| PubChem CID | 166632665 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 1-[[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]methyl]pyrrolidine |
| SMILES | c1cc2c(s1)[C@H](CN1CCCC1)OCC2 |
| InChI | InChI=1S/C12H17NOS/c1-2-6-13(5-1)9-11-12-10(3-7-14-11)4-8-15-12/h4,8,11H,1-3,5-7,9H2/t11-/m0/s1 |
| InChIKey | FWJXTGZOPGGPFU-NSHDSACASA-N |
| XLogP | 2.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]methyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]methyl]pyrrolidine?
The IUPAC name of 1-[[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]methyl]pyrrolidine (CID 166632665) is 1-[[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]methyl]pyrrolidine.
What is the SMILES notation for 1-[[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]methyl]pyrrolidine?
The canonical SMILES for 1-[[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]methyl]pyrrolidine is c1cc2c(s1)[C@H](CN1CCCC1)OCC2.
What is the InChIKey of 1-[[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]methyl]pyrrolidine?
The InChIKey is FWJXTGZOPGGPFU-NSHDSACASA-N. The full InChI is InChI=1S/C12H17NOS/c1-2-6-13(5-1)9-11-12-10(3-7-14-11)4-8-15-12/h4,8,11H,1-3,5-7,9H2/t11-/m0/s1.
What are the key properties of 1-[[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]methyl]pyrrolidine?
1-[[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]methyl]pyrrolidine has a molecular weight of 223.34 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]methyl]pyrrolidine is sourced from PubChem (CID 166632665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).