C27H32N2O3 — CID 166632673
[(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-(4-acetamidophenyl)benzoate (PubChem CID 166632673) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is [(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-(4-acetamidophenyl)benzoate.
| Compound Name | [(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-(4-acetamidophenyl)benzoate |
|---|---|
| PubChem CID | 166632673 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | [(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-(4-acetamidophenyl)benzoate |
| SMILES | C=C1[C@@H]2CCC[C@@]1(COC(=O)c1ccccc1-c1ccc(NC(C)=O)cc1)CN(CC)C2 |
| InChI | InChI=1S/C27H32N2O3/c1-4-29-16-22-8-7-15-27(17-29,19(22)2)18-32-26(31)25-10-6-5-9-24(25)21-11-13-23(14-12-21)28-20(3)30/h5-6,9-14,22H,2,4,7-8,15-18H2,1,3H3,(H,28,30)/t22-,27+/m1/s1 |
| InChIKey | OKHMPYQXKUJFOG-AMGIVPHBSA-N |
| XLogP | 5.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|