C27H29N7O4S — CID 166632713
4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]-2-[4-[3-(sulfamoylamino)pyrrolidin-1-yl]anilino]-5,7-dihydrofuro[3,4-d]pyrimidine (PubChem CID 166632713) has the molecular formula C27H29N7O4S and a molecular weight of 547.64 g/mol. Its IUPAC name is 4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]-2-[4-[3-(sulfamoylamino)pyrrolidin-1-yl]anilino]-5,7-dihydrofuro[3,4-d]pyrimidine.
| Compound Name | 4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]-2-[4-[3-(sulfamoylamino)pyrrolidin-1-yl]anilino]-5,7-dihydrofuro[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 166632713 |
| Molecular Formula | C27H29N7O4S |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]-2-[4-[3-(sulfamoylamino)pyrrolidin-1-yl]anilino]-5,7-dihydrofuro[3,4-d]pyrimidine |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1Oc1nc(Nc2ccc(N3CCC(NS(N)(=O)=O)C3)cc2)nc2c1COC2 |
| InChI | InChI=1S/C27H29N7O4S/c1-17-12-19(4-3-10-28)13-18(2)25(17)38-26-23-15-37-16-24(23)31-27(32-26)30-20-5-7-22(8-6-20)34-11-9-21(14-34)33-39(29,35)36/h3-8,12-13,21,33H,9,11,14-16H2,1-2H3,(H2,29,35,36)(H,30,31,32)/b4-3+ |
| InChIKey | SWBGGTKKECRUMT-ONEGZZNKSA-N |
| XLogP | 3.57 |
| TPSA | 155.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|