C40H51N — CID 166632730
(14R,15S,18R,19R,22S,23S)-14,18-dimethyl-19-[(2R)-6-methylheptan-2-yl]-3-phenyl-10-azahexacyclo[12.11.0.02,11.04,9.015,23.018,22]pentacosa-1(25),2,4,6,8,10-hexaene (PubChem CID 166632730) has the molecular formula C40H51N and a molecular weight of 545.86 g/mol. Its IUPAC name is (14R,15S,18R,19R,22S,23S)-14,18-dimethyl-19-[(2R)-6-methylheptan-2-yl]-3-phenyl-10-azahexacyclo[12.11.0.02,11.04,9.015,23.018,22]pentacosa-1(25),2,4,6,8,10-hexaene.
| Compound Name | (14R,15S,18R,19R,22S,23S)-14,18-dimethyl-19-[(2R)-6-methylheptan-2-yl]-3-phenyl-10-azahexacyclo[12.11.0.02,11.04,9.015,23.018,22]pentacosa-1(25),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 166632730 |
| Molecular Formula | C40H51N |
| Molecular Weight | 545.86 g/mol |
| Exact Mass | 545.40 |
| IUPAC Name | (14R,15S,18R,19R,22S,23S)-14,18-dimethyl-19-[(2R)-6-methylheptan-2-yl]-3-phenyl-10-azahexacyclo[12.11.0.02,11.04,9.015,23.018,22]pentacosa-1(25),2,4,6,8,10-hexaene |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4c5c(nc6ccccc6c5-c5ccccc5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C40H51N/c1-26(2)12-11-13-27(3)31-20-21-32-29-18-19-34-38-36(23-25-40(34,5)33(29)22-24-39(31,32)4)41-35-17-10-9-16-30(35)37(38)28-14-7-6-8-15-28/h6-10,14-17,19,26-27,29,31-33H,11-13,18,20-25H2,1-5H3/t27-,29+,31-,32+,33+,39-,40-/m1/s1 |
| InChIKey | HYTGMSHHUOBRCK-HRJQITQKSA-N |
| XLogP | 11.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.86 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |