About 2-[6-(methylamino)-3-pyridinyl]-1,3-benzothiazol-6-ol
2-[6-(methylamino)-3-pyridinyl]-1,3-benzothiazol-6-ol (PubChem CID 16663275) has the molecular formula C13H11N3OS
and a molecular weight of 257.32 g/mol. Its IUPAC name is 2-[6-(methylamino)-3-pyridinyl]-1,3-benzothiazol-6-ol.
Molecular Properties
| Compound Name | 2-[6-(methylamino)-3-pyridinyl]-1,3-benzothiazol-6-ol |
| PubChem CID | 16663275 |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 2-[6-(methylamino)-3-pyridinyl]-1,3-benzothiazol-6-ol |
| SMILES | CNc1ccc(-c2nc3ccc(O)cc3s2)cn1 |
| InChI | InChI=1S/C13H11N3OS/c1-14-12-5-2-8(7-15-12)13-16-10-4-3-9(17)6-11(10)18-13/h2-7,17H,1H3,(H,14,15) |
| InChIKey | FYTAUNFPOYWHBC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[6-(methylamino)-3-pyridinyl]-1,3-benzothiazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(methylamino)-3-pyridinyl]-1,3-benzothiazol-6-ol?
The IUPAC name of 2-[6-(methylamino)-3-pyridinyl]-1,3-benzothiazol-6-ol (CID 16663275) is 2-[6-(methylamino)-3-pyridinyl]-1,3-benzothiazol-6-ol.
What is the SMILES notation for 2-[6-(methylamino)-3-pyridinyl]-1,3-benzothiazol-6-ol?
The canonical SMILES for 2-[6-(methylamino)-3-pyridinyl]-1,3-benzothiazol-6-ol is CNc1ccc(-c2nc3ccc(O)cc3s2)cn1.
What is the InChIKey of 2-[6-(methylamino)-3-pyridinyl]-1,3-benzothiazol-6-ol?
The InChIKey is FYTAUNFPOYWHBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3OS/c1-14-12-5-2-8(7-15-12)13-16-10-4-3-9(17)6-11(10)18-13/h2-7,17H,1H3,(H,14,15).
What are the key properties of 2-[6-(methylamino)-3-pyridinyl]-1,3-benzothiazol-6-ol?
2-[6-(methylamino)-3-pyridinyl]-1,3-benzothiazol-6-ol has a molecular weight of 257.32 g/mol, XLogP of 3.11, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(methylamino)-3-pyridinyl]-1,3-benzothiazol-6-ol is sourced from PubChem (CID 16663275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).