C23H43N3O3 — CID 166632819
tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]oct-5-en-4-yl]carbamate (PubChem CID 166632819) has the molecular formula C23H43N3O3 and a molecular weight of 409.62 g/mol. Its IUPAC name is tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]oct-5-en-4-yl]carbamate.
| Compound Name | tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]oct-5-en-4-yl]carbamate |
|---|---|
| PubChem CID | 166632819 |
| Molecular Formula | C23H43N3O3 |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.33 |
| IUPAC Name | tert-butyl N-[(E,4S)-2-methyl-8-oxo-8-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]oct-5-en-4-yl]carbamate |
| SMILES | CC(C)C[C@@H](/C=C/CC(=O)NC1CC(C)(C)NC(C)(C)C1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H43N3O3/c1-16(2)13-17(25-20(28)29-21(3,4)5)11-10-12-19(27)24-18-14-22(6,7)26-23(8,9)15-18/h10-11,16-18,26H,12-15H2,1-9H3,(H,24,27)(H,25,28)/b11-10+/t17-/m1/s1 |
| InChIKey | GDSZVSVBWMVWHT-SXSDINLZSA-N |
| XLogP | 4.30 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|