C28H36O4 — CID 166632864
[(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-6-hydroxy-2,4,7,14-tetramethyl-10-methylidene-9-oxo-3-tricyclo[5.4.3.01,8]tetradecanyl] benzoate (PubChem CID 166632864) has the molecular formula C28H36O4 and a molecular weight of 436.59 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-6-hydroxy-2,4,7,14-tetramethyl-10-methylidene-9-oxo-3-tricyclo[5.4.3.01,8]tetradecanyl] benzoate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-6-hydroxy-2,4,7,14-tetramethyl-10-methylidene-9-oxo-3-tricyclo[5.4.3.01,8]tetradecanyl] benzoate |
|---|---|
| PubChem CID | 166632864 |
| Molecular Formula | C28H36O4 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-6-hydroxy-2,4,7,14-tetramethyl-10-methylidene-9-oxo-3-tricyclo[5.4.3.01,8]tetradecanyl] benzoate |
| SMILES | C=C[C@]1(C)C[C@@H](O)[C@]2(C)[C@H](C)CC[C@]3(CC(=C)C(=O)[C@H]32)[C@@H](C)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H36O4/c1-7-26(5)16-21(29)27(6)18(3)13-14-28(15-17(2)22(30)23(27)28)19(4)24(26)32-25(31)20-11-9-8-10-12-20/h7-12,18-19,21,23-24,29H,1-2,13-16H2,3-6H3/t18-,19+,21-,23+,24+,26-,27+,28+/m1/s1 |
| InChIKey | ZXBNYOGCNGPVMP-BXMVCCEJSA-N |
| XLogP | 5.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|