C37H50O6 — CID 166632970
3-[2-(1-adamantyl)acetyl]oxypropyl (E,4S)-4-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]pent-2-enoate (PubChem CID 166632970) has the molecular formula C37H50O6 and a molecular weight of 590.80 g/mol. Its IUPAC name is 3-[2-(1-adamantyl)acetyl]oxypropyl (E,4S)-4-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]pent-2-enoate.
| Compound Name | 3-[2-(1-adamantyl)acetyl]oxypropyl (E,4S)-4-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]pent-2-enoate |
|---|---|
| PubChem CID | 166632970 |
| Molecular Formula | C37H50O6 |
| Molecular Weight | 590.80 g/mol |
| Exact Mass | 590.36 |
| IUPAC Name | 3-[2-(1-adamantyl)acetyl]oxypropyl (E,4S)-4-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]pent-2-enoate |
| SMILES | CC1=CC(=O)[C@H]2/C(C=O)=C\C[C@H]3[C@@H]([C@@H](C)/C=C/C(=O)OCCCOC(=O)CC45CC6CC(CC(C6)C4)C5)CC[C@]3(C)C[C@H]12 |
| InChI | InChI=1S/C37H50O6/c1-23(29-9-10-36(3)20-30-24(2)13-32(39)35(30)28(22-38)6-7-31(29)36)5-8-33(40)42-11-4-12-43-34(41)21-37-17-25-14-26(18-37)16-27(15-25)19-37/h5-6,8,13,22-23,25-27,29-31,35H,4,7,9-12,14-21H2,1-3H3/b8-5+,28-6-/t23-,25?,26?,27?,29+,30+,31-,35-,36+,37?/m0/s1 |
| InChIKey | UUABKEZZCXQRQP-HLFRPLAMSA-N |
| XLogP | 6.97 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.80 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|