C28H29N5O2 — CID 166633107
1-(5-hydroxypentyl)-4-methyl-5-phenyl-N-(3-phenyldiazenylphenyl)pyrazole-3-carboxamide (PubChem CID 166633107) has the molecular formula C28H29N5O2 and a molecular weight of 467.57 g/mol. Its IUPAC name is 1-(5-hydroxypentyl)-4-methyl-5-phenyl-N-(3-phenyldiazenylphenyl)pyrazole-3-carboxamide.
| Compound Name | 1-(5-hydroxypentyl)-4-methyl-5-phenyl-N-(3-phenyldiazenylphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 166633107 |
| Molecular Formula | C28H29N5O2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 1-(5-hydroxypentyl)-4-methyl-5-phenyl-N-(3-phenyldiazenylphenyl)pyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cccc(/N=N/c3ccccc3)c2)nn(CCCCCO)c1-c1ccccc1 |
| InChI | InChI=1S/C28H29N5O2/c1-21-26(32-33(18-9-4-10-19-34)27(21)22-12-5-2-6-13-22)28(35)29-24-16-11-17-25(20-24)31-30-23-14-7-3-8-15-23/h2-3,5-8,11-17,20,34H,4,9-10,18-19H2,1H3,(H,29,35)/b31-30+ |
| InChIKey | BLXCDDXHZGXKFR-NVQSTNCTSA-N |
| XLogP | 6.69 |
| TPSA | 91.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|