About ethyl (2Z)-2-[(1S,5S)-5-(3-hydroxyphenyl)-2-azabicyclo[3.3.1]nonan-9-ylidene]acetate
ethyl (2Z)-2-[(1S,5S)-5-(3-hydroxyphenyl)-2-azabicyclo[3.3.1]nonan-9-ylidene]acetate (PubChem CID 166633199) has the molecular formula C18H23NO3
and a molecular weight of 301.39 g/mol. Its IUPAC name is ethyl (2Z)-2-[(1S,5S)-5-(3-hydroxyphenyl)-2-azabicyclo[3.3.1]nonan-9-ylidene]acetate.
Molecular Properties
| Compound Name | ethyl (2Z)-2-[(1S,5S)-5-(3-hydroxyphenyl)-2-azabicyclo[3.3.1]nonan-9-ylidene]acetate |
| PubChem CID | 166633199 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | ethyl (2Z)-2-[(1S,5S)-5-(3-hydroxyphenyl)-2-azabicyclo[3.3.1]nonan-9-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\[C@@H]2CCC[C@@]1(c1cccc(O)c1)CCN2 |
| InChI | InChI=1S/C18H23NO3/c1-2-22-17(21)12-15-16-7-4-8-18(15,9-10-19-16)13-5-3-6-14(20)11-13/h3,5-6,11-12,16,19-20H,2,4,7-10H2,1H3/b15-12+/t16-,18-/m0/s1 |
| InChIKey | CERQQXVWKFJWFS-QUJHGWJTSA-N |
| XLogP | 2.67 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2Z)-2-[(1S,5S)-5-(3-hydroxyphenyl)-2-azabicyclo[3.3.1]nonan-9-ylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2Z)-2-[(1S,5S)-5-(3-hydroxyphenyl)-2-azabicyclo[3.3.1]nonan-9-ylidene]acetate?
The IUPAC name of ethyl (2Z)-2-[(1S,5S)-5-(3-hydroxyphenyl)-2-azabicyclo[3.3.1]nonan-9-ylidene]acetate (CID 166633199) is ethyl (2Z)-2-[(1S,5S)-5-(3-hydroxyphenyl)-2-azabicyclo[3.3.1]nonan-9-ylidene]acetate.
What is the SMILES notation for ethyl (2Z)-2-[(1S,5S)-5-(3-hydroxyphenyl)-2-azabicyclo[3.3.1]nonan-9-ylidene]acetate?
The canonical SMILES for ethyl (2Z)-2-[(1S,5S)-5-(3-hydroxyphenyl)-2-azabicyclo[3.3.1]nonan-9-ylidene]acetate is CCOC(=O)/C=C1\[C@@H]2CCC[C@@]1(c1cccc(O)c1)CCN2.
What is the InChIKey of ethyl (2Z)-2-[(1S,5S)-5-(3-hydroxyphenyl)-2-azabicyclo[3.3.1]nonan-9-ylidene]acetate?
The InChIKey is CERQQXVWKFJWFS-QUJHGWJTSA-N. The full InChI is InChI=1S/C18H23NO3/c1-2-22-17(21)12-15-16-7-4-8-18(15,9-10-19-16)13-5-3-6-14(20)11-13/h3,5-6,11-12,16,19-20H,2,4,7-10H2,1H3/b15-12+/t16-,18-/m0/s1.
What are the key properties of ethyl (2Z)-2-[(1S,5S)-5-(3-hydroxyphenyl)-2-azabicyclo[3.3.1]nonan-9-ylidene]acetate?
ethyl (2Z)-2-[(1S,5S)-5-(3-hydroxyphenyl)-2-azabicyclo[3.3.1]nonan-9-ylidene]acetate has a molecular weight of 301.39 g/mol, XLogP of 2.67, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2Z)-2-[(1S,5S)-5-(3-hydroxyphenyl)-2-azabicyclo[3.3.1]nonan-9-ylidene]acetate is sourced from PubChem (CID 166633199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).