C25H20FN3O4 — CID 166633269
(3R)-2-(5-fluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (PubChem CID 166633269) has the molecular formula C25H20FN3O4 and a molecular weight of 445.45 g/mol. Its IUPAC name is (3R)-2-(5-fluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione.
| Compound Name | (3R)-2-(5-fluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 166633269 |
| Molecular Formula | C25H20FN3O4 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | (3R)-2-(5-fluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)-11-hydroxy-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N(C2c3ccccc3C=Cc3ccc(F)cc32)[C@@H]2COCCN12 |
| InChI | InChI=1S/C25H20FN3O4/c26-17-8-7-16-6-5-15-3-1-2-4-18(15)22(19(16)13-17)29-21-14-33-12-11-27(21)25(32)23-24(31)20(30)9-10-28(23)29/h1-10,13,21-22,31H,11-12,14H2/t21-,22?/m1/s1 |
| InChIKey | WVRQLVBOGQSLHF-ZMFCMNQTSA-N |
| XLogP | 2.72 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|