About (E)-3-[2,5-dimethoxy-4-(2-methylsulfonylphenyl)phenyl]-1-(4-fluorophenyl)prop-2-en-1-one
(E)-3-[2,5-dimethoxy-4-(2-methylsulfonylphenyl)phenyl]-1-(4-fluorophenyl)prop-2-en-1-one (PubChem CID 166633450) has the molecular formula C24H21FO5S
and a molecular weight of 440.49 g/mol. Its IUPAC name is (E)-3-[2,5-dimethoxy-4-(2-methylsulfonylphenyl)phenyl]-1-(4-fluorophenyl)prop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-3-[2,5-dimethoxy-4-(2-methylsulfonylphenyl)phenyl]-1-(4-fluorophenyl)prop-2-en-1-one |
| PubChem CID | 166633450 |
| Molecular Formula | C24H21FO5S |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | (E)-3-[2,5-dimethoxy-4-(2-methylsulfonylphenyl)phenyl]-1-(4-fluorophenyl)prop-2-en-1-one |
| SMILES | COc1cc(-c2ccccc2S(C)(=O)=O)c(OC)cc1/C=C/C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H21FO5S/c1-29-22-15-20(19-6-4-5-7-24(19)31(3,27)28)23(30-2)14-17(22)10-13-21(26)16-8-11-18(25)12-9-16/h4-15H,1-3H3/b13-10+ |
| InChIKey | FMNAQWSTNYMGQS-JLHYYAGUSA-N |
| XLogP | 4.81 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[2,5-dimethoxy-4-(2-methylsulfonylphenyl)phenyl]-1-(4-fluorophenyl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[2,5-dimethoxy-4-(2-methylsulfonylphenyl)phenyl]-1-(4-fluorophenyl)prop-2-en-1-one?
The IUPAC name of (E)-3-[2,5-dimethoxy-4-(2-methylsulfonylphenyl)phenyl]-1-(4-fluorophenyl)prop-2-en-1-one (CID 166633450) is (E)-3-[2,5-dimethoxy-4-(2-methylsulfonylphenyl)phenyl]-1-(4-fluorophenyl)prop-2-en-1-one.
What is the SMILES notation for (E)-3-[2,5-dimethoxy-4-(2-methylsulfonylphenyl)phenyl]-1-(4-fluorophenyl)prop-2-en-1-one?
The canonical SMILES for (E)-3-[2,5-dimethoxy-4-(2-methylsulfonylphenyl)phenyl]-1-(4-fluorophenyl)prop-2-en-1-one is COc1cc(-c2ccccc2S(C)(=O)=O)c(OC)cc1/C=C/C(=O)c1ccc(F)cc1.
What is the InChIKey of (E)-3-[2,5-dimethoxy-4-(2-methylsulfonylphenyl)phenyl]-1-(4-fluorophenyl)prop-2-en-1-one?
The InChIKey is FMNAQWSTNYMGQS-JLHYYAGUSA-N. The full InChI is InChI=1S/C24H21FO5S/c1-29-22-15-20(19-6-4-5-7-24(19)31(3,27)28)23(30-2)14-17(22)10-13-21(26)16-8-11-18(25)12-9-16/h4-15H,1-3H3/b13-10+.
What are the key properties of (E)-3-[2,5-dimethoxy-4-(2-methylsulfonylphenyl)phenyl]-1-(4-fluorophenyl)prop-2-en-1-one?
(E)-3-[2,5-dimethoxy-4-(2-methylsulfonylphenyl)phenyl]-1-(4-fluorophenyl)prop-2-en-1-one has a molecular weight of 440.49 g/mol, XLogP of 4.81, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[2,5-dimethoxy-4-(2-methylsulfonylphenyl)phenyl]-1-(4-fluorophenyl)prop-2-en-1-one is sourced from PubChem (CID 166633450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).