C26H38O4 — CID 166633454
[(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-6-hydroxy-2,4,7,14-tetramethyl-10-methylidene-9-oxo-3-tricyclo[5.4.3.01,8]tetradecanyl] cyclobutanecarboxylate (PubChem CID 166633454) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-6-hydroxy-2,4,7,14-tetramethyl-10-methylidene-9-oxo-3-tricyclo[5.4.3.01,8]tetradecanyl] cyclobutanecarboxylate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-6-hydroxy-2,4,7,14-tetramethyl-10-methylidene-9-oxo-3-tricyclo[5.4.3.01,8]tetradecanyl] cyclobutanecarboxylate |
|---|---|
| PubChem CID | 166633454 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-6-hydroxy-2,4,7,14-tetramethyl-10-methylidene-9-oxo-3-tricyclo[5.4.3.01,8]tetradecanyl] cyclobutanecarboxylate |
| SMILES | C=C[C@]1(C)C[C@@H](O)[C@]2(C)[C@H](C)CC[C@]3(CC(=C)C(=O)[C@H]32)[C@@H](C)[C@@H]1OC(=O)C1CCC1 |
| InChI | InChI=1S/C26H38O4/c1-7-24(5)14-19(27)25(6)16(3)11-12-26(13-15(2)20(28)21(25)26)17(4)22(24)30-23(29)18-9-8-10-18/h7,16-19,21-22,27H,1-2,8-14H2,3-6H3/t16-,17+,19-,21+,22+,24-,25+,26+/m1/s1 |
| InChIKey | QKPKKXUMFHXPHJ-ZHLRGWEPSA-N |
| XLogP | 4.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|