C18H22O3 — CID 166633524
(1R,8S,10R)-4-hydroxy-5,11,11-trimethyl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2(7),3,5-trien-12-one (PubChem CID 166633524) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is (1R,8S,10R)-4-hydroxy-5,11,11-trimethyl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2(7),3,5-trien-12-one.
| Compound Name | (1R,8S,10R)-4-hydroxy-5,11,11-trimethyl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2(7),3,5-trien-12-one |
|---|---|
| PubChem CID | 166633524 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (1R,8S,10R)-4-hydroxy-5,11,11-trimethyl-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2(7),3,5-trien-12-one |
| SMILES | Cc1cc2c(cc1O)[C@@]13CCC(=O)C(C)(C)[C@@H]1C[C@@H]2OC3 |
| InChI | InChI=1S/C18H22O3/c1-10-6-11-12(7-13(10)19)18-5-4-16(20)17(2,3)15(18)8-14(11)21-9-18/h6-7,14-15,19H,4-5,8-9H2,1-3H3/t14-,15-,18-/m0/s1 |
| InChIKey | ZITVGQMMFYZHEC-MPGHIAIKSA-N |
| XLogP | 3.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |