C26H22N8O2 — CID 166633598
4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]-N-(2-aminophenyl)benzamide (PubChem CID 166633598) has the molecular formula C26H22N8O2 and a molecular weight of 478.52 g/mol. Its IUPAC name is 4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]-N-(2-aminophenyl)benzamide.
| Compound Name | 4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]-N-(2-aminophenyl)benzamide |
|---|---|
| PubChem CID | 166633598 |
| Molecular Formula | C26H22N8O2 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]-N-(2-aminophenyl)benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CCn2ccc3c2nc(N)n2nc(-c4ccco4)nc32)cc1 |
| InChI | InChI=1S/C26H22N8O2/c27-19-4-1-2-5-20(19)29-25(35)17-9-7-16(8-10-17)11-13-33-14-12-18-23(33)31-26(28)34-24(18)30-22(32-34)21-6-3-15-36-21/h1-10,12,14-15H,11,13,27H2,(H2,28,31)(H,29,35) |
| InChIKey | GHOMFFHRIOBIKE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 142.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|