About 4-[[4-(2,6-dimethyl-4-thiophen-2-ylanilino)pyrimidin-2-yl]amino]benzonitrile
4-[[4-(2,6-dimethyl-4-thiophen-2-ylanilino)pyrimidin-2-yl]amino]benzonitrile (PubChem CID 166633622) has the molecular formula C23H19N5S
and a molecular weight of 397.51 g/mol. Its IUPAC name is 4-[[4-(2,6-dimethyl-4-thiophen-2-ylanilino)pyrimidin-2-yl]amino]benzonitrile.
Molecular Properties
| Compound Name | 4-[[4-(2,6-dimethyl-4-thiophen-2-ylanilino)pyrimidin-2-yl]amino]benzonitrile |
| PubChem CID | 166633622 |
| Molecular Formula | C23H19N5S |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 4-[[4-(2,6-dimethyl-4-thiophen-2-ylanilino)pyrimidin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(-c2cccs2)cc(C)c1Nc1ccnc(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C23H19N5S/c1-15-12-18(20-4-3-11-29-20)13-16(2)22(15)27-21-9-10-25-23(28-21)26-19-7-5-17(14-24)6-8-19/h3-13H,1-2H3,(H2,25,26,27,28) |
| InChIKey | ANBPWHFMDWQQML-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[4-(2,6-dimethyl-4-thiophen-2-ylanilino)pyrimidin-2-yl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(2,6-dimethyl-4-thiophen-2-ylanilino)pyrimidin-2-yl]amino]benzonitrile?
The IUPAC name of 4-[[4-(2,6-dimethyl-4-thiophen-2-ylanilino)pyrimidin-2-yl]amino]benzonitrile (CID 166633622) is 4-[[4-(2,6-dimethyl-4-thiophen-2-ylanilino)pyrimidin-2-yl]amino]benzonitrile.
What is the SMILES notation for 4-[[4-(2,6-dimethyl-4-thiophen-2-ylanilino)pyrimidin-2-yl]amino]benzonitrile?
The canonical SMILES for 4-[[4-(2,6-dimethyl-4-thiophen-2-ylanilino)pyrimidin-2-yl]amino]benzonitrile is Cc1cc(-c2cccs2)cc(C)c1Nc1ccnc(Nc2ccc(C#N)cc2)n1.
What is the InChIKey of 4-[[4-(2,6-dimethyl-4-thiophen-2-ylanilino)pyrimidin-2-yl]amino]benzonitrile?
The InChIKey is ANBPWHFMDWQQML-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N5S/c1-15-12-18(20-4-3-11-29-20)13-16(2)22(15)27-21-9-10-25-23(28-21)26-19-7-5-17(14-24)6-8-19/h3-13H,1-2H3,(H2,25,26,27,28).
What are the key properties of 4-[[4-(2,6-dimethyl-4-thiophen-2-ylanilino)pyrimidin-2-yl]amino]benzonitrile?
4-[[4-(2,6-dimethyl-4-thiophen-2-ylanilino)pyrimidin-2-yl]amino]benzonitrile has a molecular weight of 397.51 g/mol, XLogP of 6.18, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(2,6-dimethyl-4-thiophen-2-ylanilino)pyrimidin-2-yl]amino]benzonitrile is sourced from PubChem (CID 166633622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).