C23H28N6OS — CID 166633627
3-[[6-methyl-2-[[2-(2-methylpropylamino)-1,3-benzothiazol-6-yl]amino]quinazolin-4-yl]amino]propan-1-ol (PubChem CID 166633627) has the molecular formula C23H28N6OS and a molecular weight of 436.59 g/mol. Its IUPAC name is 3-[[6-methyl-2-[[2-(2-methylpropylamino)-1,3-benzothiazol-6-yl]amino]quinazolin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[6-methyl-2-[[2-(2-methylpropylamino)-1,3-benzothiazol-6-yl]amino]quinazolin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 166633627 |
| Molecular Formula | C23H28N6OS |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 3-[[6-methyl-2-[[2-(2-methylpropylamino)-1,3-benzothiazol-6-yl]amino]quinazolin-4-yl]amino]propan-1-ol |
| SMILES | Cc1ccc2nc(Nc3ccc4nc(NCC(C)C)sc4c3)nc(NCCCO)c2c1 |
| InChI | InChI=1S/C23H28N6OS/c1-14(2)13-25-23-28-19-8-6-16(12-20(19)31-23)26-22-27-18-7-5-15(3)11-17(18)21(29-22)24-9-4-10-30/h5-8,11-12,14,30H,4,9-10,13H2,1-3H3,(H,25,28)(H2,24,26,27,29) |
| InChIKey | AAQPNYGVRDQNQJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|