C37H27BF2IN3O4 — CID 166633686
2-[[3,3-difluoro-6-iodo-5-(4-methoxyphenyl)-7,11-diphenyl-2,9-diaza-4-azonia-3-boranuidapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(12),4,6,8,10,15(20),16,18-octaen-17-yl]oxy]acetic acid (PubChem CID 166633686) has the molecular formula C37H27BF2IN3O4 and a molecular weight of 753.35 g/mol. Its IUPAC name is 2-[[3,3-difluoro-6-iodo-5-(4-methoxyphenyl)-7,11-diphenyl-2,9-diaza-4-azonia-3-boranuidapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(12),4,6,8,10,15(20),16,18-octaen-17-yl]oxy]acetic acid.
| Compound Name | 2-[[3,3-difluoro-6-iodo-5-(4-methoxyphenyl)-7,11-diphenyl-2,9-diaza-4-azonia-3-boranuidapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(12),4,6,8,10,15(20),16,18-octaen-17-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 166633686 |
| Molecular Formula | C37H27BF2IN3O4 |
| Molecular Weight | 753.35 g/mol |
| Exact Mass | 753.11 |
| IUPAC Name | 2-[[3,3-difluoro-6-iodo-5-(4-methoxyphenyl)-7,11-diphenyl-2,9-diaza-4-azonia-3-boranuidapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(12),4,6,8,10,15(20),16,18-octaen-17-yl]oxy]acetic acid |
| SMILES | COc1ccc(C2=[N+]3C(=Nc4c(-c5ccccc5)c5c(n4[B-]3(F)F)-c3ccc(OCC(=O)O)cc3CC5)C(c3ccccc3)=C2I)cc1 |
| InChI | InChI=1S/C37H27BF2IN3O4/c1-47-26-15-12-24(13-16-26)34-33(41)32(23-10-6-3-7-11-23)37-42-36-31(22-8-4-2-5-9-22)29-18-14-25-20-27(48-21-30(45)46)17-19-28(25)35(29)44(36)38(39,40)43(34)37/h2-13,15-17,19-20H,14,18,21H2,1H3,(H,45,46) |
| InChIKey | PYKDCILKJWFQTQ-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 76.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.35 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|