C26H32N5O8P — CID 166633704
butyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166633704) has the molecular formula C26H32N5O8P and a molecular weight of 573.54 g/mol. Its IUPAC name is butyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166633704 |
| Molecular Formula | C26H32N5O8P |
| Molecular Weight | 573.54 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | butyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@@]1(O)[C@H](O)[C@@H](COP(=O)(N[C@@H](C)C(=O)OCCCC)Oc2ccccc2)O[C@H]1n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C26H32N5O8P/c1-4-6-14-36-24(33)17(3)30-40(35,39-18-10-8-7-9-11-18)37-15-20-21(32)26(34,5-2)25(38-20)31-13-12-19-22(27)28-16-29-23(19)31/h2,7-13,16-17,20-21,25,32,34H,4,6,14-15H2,1,3H3,(H,30,35)(H2,27,28,29)/t17-,20+,21+,25+,26+,40?/m0/s1 |
| InChIKey | VIKIJQFKXVKULM-VHWCNEIMSA-N |
| XLogP | 2.16 |
| TPSA | 180.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.54 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|