About 3-[[2-[(2-methyl-1,3-benzothiazol-6-yl)amino]quinazolin-4-yl]amino]propan-1-ol
3-[[2-[(2-methyl-1,3-benzothiazol-6-yl)amino]quinazolin-4-yl]amino]propan-1-ol (PubChem CID 166633767) has the molecular formula C19H19N5OS
and a molecular weight of 365.46 g/mol. Its IUPAC name is 3-[[2-[(2-methyl-1,3-benzothiazol-6-yl)amino]quinazolin-4-yl]amino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[[2-[(2-methyl-1,3-benzothiazol-6-yl)amino]quinazolin-4-yl]amino]propan-1-ol |
| PubChem CID | 166633767 |
| Molecular Formula | C19H19N5OS |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 3-[[2-[(2-methyl-1,3-benzothiazol-6-yl)amino]quinazolin-4-yl]amino]propan-1-ol |
| SMILES | Cc1nc2ccc(Nc3nc(NCCCO)c4ccccc4n3)cc2s1 |
| InChI | InChI=1S/C19H19N5OS/c1-12-21-16-8-7-13(11-17(16)26-12)22-19-23-15-6-3-2-5-14(15)18(24-19)20-9-4-10-25/h2-3,5-8,11,25H,4,9-10H2,1H3,(H2,20,22,23,24) |
| InChIKey | UDNVCDVRCUJVOB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2-[(2-methyl-1,3-benzothiazol-6-yl)amino]quinazolin-4-yl]amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-[(2-methyl-1,3-benzothiazol-6-yl)amino]quinazolin-4-yl]amino]propan-1-ol?
The IUPAC name of 3-[[2-[(2-methyl-1,3-benzothiazol-6-yl)amino]quinazolin-4-yl]amino]propan-1-ol (CID 166633767) is 3-[[2-[(2-methyl-1,3-benzothiazol-6-yl)amino]quinazolin-4-yl]amino]propan-1-ol.
What is the SMILES notation for 3-[[2-[(2-methyl-1,3-benzothiazol-6-yl)amino]quinazolin-4-yl]amino]propan-1-ol?
The canonical SMILES for 3-[[2-[(2-methyl-1,3-benzothiazol-6-yl)amino]quinazolin-4-yl]amino]propan-1-ol is Cc1nc2ccc(Nc3nc(NCCCO)c4ccccc4n3)cc2s1.
What is the InChIKey of 3-[[2-[(2-methyl-1,3-benzothiazol-6-yl)amino]quinazolin-4-yl]amino]propan-1-ol?
The InChIKey is UDNVCDVRCUJVOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N5OS/c1-12-21-16-8-7-13(11-17(16)26-12)22-19-23-15-6-3-2-5-14(15)18(24-19)20-9-4-10-25/h2-3,5-8,11,25H,4,9-10H2,1H3,(H2,20,22,23,24).
What are the key properties of 3-[[2-[(2-methyl-1,3-benzothiazol-6-yl)amino]quinazolin-4-yl]amino]propan-1-ol?
3-[[2-[(2-methyl-1,3-benzothiazol-6-yl)amino]quinazolin-4-yl]amino]propan-1-ol has a molecular weight of 365.46 g/mol, XLogP of 4.09, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-[(2-methyl-1,3-benzothiazol-6-yl)amino]quinazolin-4-yl]amino]propan-1-ol is sourced from PubChem (CID 166633767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).