C20H18ClN7O2 — CID 166633834
3-[[3-[(1R,5S)-3-(3-chlorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methylpyrazolo[5,1-f][1,2,4]triazin-4-one (PubChem CID 166633834) has the molecular formula C20H18ClN7O2 and a molecular weight of 423.86 g/mol. Its IUPAC name is 3-[[3-[(1R,5S)-3-(3-chlorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methylpyrazolo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 3-[[3-[(1R,5S)-3-(3-chlorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methylpyrazolo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 166633834 |
| Molecular Formula | C20H18ClN7O2 |
| Molecular Weight | 423.86 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 3-[[3-[(1R,5S)-3-(3-chlorophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]-1,2,4-oxadiazol-5-yl]methyl]-5-methylpyrazolo[5,1-f][1,2,4]triazin-4-one |
| SMILES | Cc1cnn2ncn(Cc3nc(C4[C@H]5CN(c6cccc(Cl)c6)C[C@@H]45)no3)c(=O)c12 |
| InChI | InChI=1S/C20H18ClN7O2/c1-11-6-22-28-18(11)20(29)27(10-23-28)9-16-24-19(25-30-16)17-14-7-26(8-15(14)17)13-4-2-3-12(21)5-13/h2-6,10,14-15,17H,7-9H2,1H3/t14-,15+,17? |
| InChIKey | GICRQNOMWGDHAQ-FKEKPDDDSA-N |
| XLogP | 2.13 |
| TPSA | 94.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.86 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |