C33H42N4O3 — CID 166633836
3-[4-[5-butyl-1-[4-(2,4-dimethoxyphenyl)phenyl]-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine (PubChem CID 166633836) has the molecular formula C33H42N4O3 and a molecular weight of 542.72 g/mol. Its IUPAC name is 3-[4-[5-butyl-1-[4-(2,4-dimethoxyphenyl)phenyl]-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[4-[5-butyl-1-[4-(2,4-dimethoxyphenyl)phenyl]-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 166633836 |
| Molecular Formula | C33H42N4O3 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.33 |
| IUPAC Name | 3-[4-[5-butyl-1-[4-(2,4-dimethoxyphenyl)phenyl]-1,2,4-triazol-3-yl]phenoxy]-N,N-diethylpropan-1-amine |
| SMILES | CCCCc1nc(-c2ccc(OCCCN(CC)CC)cc2)nn1-c1ccc(-c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C33H42N4O3/c1-6-9-11-32-34-33(26-14-18-28(19-15-26)40-23-10-22-36(7-2)8-3)35-37(32)27-16-12-25(13-17-27)30-21-20-29(38-4)24-31(30)39-5/h12-21,24H,6-11,22-23H2,1-5H3 |
| InChIKey | RUCYLVLNPXPQBS-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|