C27H30F3N3O — CID 166633837
6-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-2-oxa-6-azaspiro[3.3]heptane (PubChem CID 166633837) has the molecular formula C27H30F3N3O and a molecular weight of 469.55 g/mol. Its IUPAC name is 6-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-2-oxa-6-azaspiro[3.3]heptane.
| Compound Name | 6-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-2-oxa-6-azaspiro[3.3]heptane |
|---|---|
| PubChem CID | 166633837 |
| Molecular Formula | C27H30F3N3O |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 6-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-2-oxa-6-azaspiro[3.3]heptane |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(N3CC4(COC4)C3)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C27H30F3N3O/c1-16-8-19-18-6-4-5-7-22(18)31-24(19)25(33(16)11-26(2,3)30)23-20(28)9-17(10-21(23)29)32-12-27(13-32)14-34-15-27/h4-7,9-10,16,25,31H,8,11-15H2,1-3H3/t16-,25-/m1/s1 |
| InChIKey | OSUWIBXDDWIQCO-PUAOIOHZSA-N |
| XLogP | 5.37 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|