C34H40N4O5 — CID 166633908
(13-methyl-5,6,8,13a-tetrahydroisoquinolino[1,2-b]quinazolin-10-yl) N-[6-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]hexyl]carbamate (PubChem CID 166633908) has the molecular formula C34H40N4O5 and a molecular weight of 584.72 g/mol. Its IUPAC name is (13-methyl-5,6,8,13a-tetrahydroisoquinolino[1,2-b]quinazolin-10-yl) N-[6-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]hexyl]carbamate.
| Compound Name | (13-methyl-5,6,8,13a-tetrahydroisoquinolino[1,2-b]quinazolin-10-yl) N-[6-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 166633908 |
| Molecular Formula | C34H40N4O5 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | (13-methyl-5,6,8,13a-tetrahydroisoquinolino[1,2-b]quinazolin-10-yl) N-[6-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]hexyl]carbamate |
| SMILES | COc1cc(/C=C/C(=O)NCCCCCCNC(=O)Oc2ccc3c(c2)CN2CCc4ccccc4C2N3C)ccc1O |
| InChI | InChI=1S/C34H40N4O5/c1-37-29-14-13-27(22-26(29)23-38-20-17-25-9-5-6-10-28(25)33(37)38)43-34(41)36-19-8-4-3-7-18-35-32(40)16-12-24-11-15-30(39)31(21-24)42-2/h5-6,9-16,21-22,33,39H,3-4,7-8,17-20,23H2,1-2H3,(H,35,40)(H,36,41)/b16-12+ |
| InChIKey | ZUVUYXIECOMIRX-FOWTUZBSSA-N |
| XLogP | 5.39 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|