C30H33BrN6O3 — CID 166634132
(2R)-N-[(2S)-1-amino-3-(2-bromophenyl)-1-oxopropan-2-yl]-5-(diaminomethylideneamino)-2-(3,3-diphenylprop-2-enoylamino)pentanamide (PubChem CID 166634132) has the molecular formula C30H33BrN6O3 and a molecular weight of 605.54 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-amino-3-(2-bromophenyl)-1-oxopropan-2-yl]-5-(diaminomethylideneamino)-2-(3,3-diphenylprop-2-enoylamino)pentanamide.
| Compound Name | (2R)-N-[(2S)-1-amino-3-(2-bromophenyl)-1-oxopropan-2-yl]-5-(diaminomethylideneamino)-2-(3,3-diphenylprop-2-enoylamino)pentanamide |
|---|---|
| PubChem CID | 166634132 |
| Molecular Formula | C30H33BrN6O3 |
| Molecular Weight | 605.54 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | (2R)-N-[(2S)-1-amino-3-(2-bromophenyl)-1-oxopropan-2-yl]-5-(diaminomethylideneamino)-2-(3,3-diphenylprop-2-enoylamino)pentanamide |
| SMILES | NC(=O)[C@H](Cc1ccccc1Br)NC(=O)[C@@H](CCCN=C(N)N)NC(=O)C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H33BrN6O3/c31-24-15-8-7-14-22(24)18-26(28(32)39)37-29(40)25(16-9-17-35-30(33)34)36-27(38)19-23(20-10-3-1-4-11-20)21-12-5-2-6-13-21/h1-8,10-15,19,25-26H,9,16-18H2,(H2,32,39)(H,36,38)(H,37,40)(H4,33,34,35)/t25-,26+/m1/s1 |
| InChIKey | NOTBTEPSIBEBDX-FTJBHMTQSA-N |
| XLogP | 2.63 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.54 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|