C20H16F3NO5S2 — CID 166634172
N-[2-[hydroxy(phenyl)methyl]-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide (PubChem CID 166634172) has the molecular formula C20H16F3NO5S2 and a molecular weight of 471.48 g/mol. Its IUPAC name is N-[2-[hydroxy(phenyl)methyl]-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide.
| Compound Name | N-[2-[hydroxy(phenyl)methyl]-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 166634172 |
| Molecular Formula | C20H16F3NO5S2 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | N-[2-[hydroxy(phenyl)methyl]-4-(trifluoromethylsulfonyl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(S(=O)(=O)C(F)(F)F)cc1C(O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H16F3NO5S2/c21-20(22,23)30(26,27)16-11-12-18(24-31(28,29)15-9-5-2-6-10-15)17(13-16)19(25)14-7-3-1-4-8-14/h1-13,19,24-25H |
| InChIKey | ADNGMEBQXLHMCC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |