C27H30O5 — CID 166634268
[(2R,4R,9R,13R)-5,5,9-trimethyl-14-methylidene-8,10,15-trioxo-2-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] benzoate (PubChem CID 166634268) has the molecular formula C27H30O5 and a molecular weight of 434.53 g/mol. Its IUPAC name is [(2R,4R,9R,13R)-5,5,9-trimethyl-14-methylidene-8,10,15-trioxo-2-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] benzoate.
| Compound Name | [(2R,4R,9R,13R)-5,5,9-trimethyl-14-methylidene-8,10,15-trioxo-2-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] benzoate |
|---|---|
| PubChem CID | 166634268 |
| Molecular Formula | C27H30O5 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | [(2R,4R,9R,13R)-5,5,9-trimethyl-14-methylidene-8,10,15-trioxo-2-tricyclo[11.2.1.04,9]hexadec-1(16)-enyl] benzoate |
| SMILES | C=C1C(=O)C2=C[C@H]1CCC(=O)[C@]1(C)C(=O)CCC(C)(C)[C@H]1C[C@H]2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H30O5/c1-16-18-10-11-22(28)27(4)21(26(2,3)13-12-23(27)29)15-20(19(14-18)24(16)30)32-25(31)17-8-6-5-7-9-17/h5-9,14,18,20-21H,1,10-13,15H2,2-4H3/t18-,20-,21-,27-/m1/s1 |
| InChIKey | IDLSLOREIGPSNA-YOGNJOHTSA-N |
| XLogP | 4.66 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|