C12H14O5 — CID 166634275
(1S,6R)-1-[(1R)-1-hydroxy-3-methylbut-2-enyl]-4-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione (PubChem CID 166634275) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is (1S,6R)-1-[(1R)-1-hydroxy-3-methylbut-2-enyl]-4-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione.
| Compound Name | (1S,6R)-1-[(1R)-1-hydroxy-3-methylbut-2-enyl]-4-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
|---|---|
| PubChem CID | 166634275 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (1S,6R)-1-[(1R)-1-hydroxy-3-methylbut-2-enyl]-4-methoxy-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
| SMILES | COC1=CC(=O)[C@@]2([C@H](O)C=C(C)C)O[C@H]2C1=O |
| InChI | InChI=1S/C12H14O5/c1-6(2)4-8(13)12-9(14)5-7(16-3)10(15)11(12)17-12/h4-5,8,11,13H,1-3H3/t8-,11+,12-/m1/s1 |
| InChIKey | LLCQVDATPUDGJG-JFUSQASVSA-N |
| XLogP | 0.13 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|