C28H36N5O8P — CID 166634280
propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylpentanoate (PubChem CID 166634280) has the molecular formula C28H36N5O8P and a molecular weight of 601.60 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylpentanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 166634280 |
| Molecular Formula | C28H36N5O8P |
| Molecular Weight | 601.60 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylpentanoate |
| SMILES | C#C[C@@]1(O)[C@H](O)[C@@H](COP(=O)(N[C@H](CC(C)C)C(=O)OC(C)C)Oc2ccccc2)O[C@H]1n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C28H36N5O8P/c1-6-28(36)23(34)22(40-27(28)33-13-12-20-24(29)30-16-31-25(20)33)15-38-42(37,41-19-10-8-7-9-11-19)32-21(14-17(2)3)26(35)39-18(4)5/h1,7-13,16-18,21-23,27,34,36H,14-15H2,2-5H3,(H,32,37)(H2,29,30,31)/t21-,22-,23-,27-,28-,42?/m1/s1 |
| InChIKey | YTIUAWWIJOXSGM-RGVGMIHUSA-N |
| XLogP | 2.80 |
| TPSA | 180.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.60 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|