C28H41N3O7 — CID 166634303
[(Z)-4-[[(2S)-2-[[(2Z,4Z,6E,8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoyl]amino]-3,3-dimethylbutanoyl]amino]-3-methylbut-3-enyl] carbamate (PubChem CID 166634303) has the molecular formula C28H41N3O7 and a molecular weight of 531.65 g/mol. Its IUPAC name is [(Z)-4-[[(2S)-2-[[(2Z,4Z,6E,8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoyl]amino]-3,3-dimethylbutanoyl]amino]-3-methylbut-3-enyl] carbamate.
| Compound Name | [(Z)-4-[[(2S)-2-[[(2Z,4Z,6E,8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoyl]amino]-3,3-dimethylbutanoyl]amino]-3-methylbut-3-enyl] carbamate |
|---|---|
| PubChem CID | 166634303 |
| Molecular Formula | C28H41N3O7 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | [(Z)-4-[[(2S)-2-[[(2Z,4Z,6E,8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoyl]amino]-3,3-dimethylbutanoyl]amino]-3-methylbut-3-enyl] carbamate |
| SMILES | COC1=CC[C@@H]([C@@H](C)/C=C(C)/C=C\C=C/C(=O)N[C@H](C(=O)N/C=C(/C)CCOC(N)=O)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C28H41N3O7/c1-18(16-20(3)21-12-13-22(36-7)26(34)38-21)10-8-9-11-23(32)31-24(28(4,5)6)25(33)30-17-19(2)14-15-37-27(29)35/h8-11,13,16-17,20-21,24H,12,14-15H2,1-7H3,(H2,29,35)(H,30,33)(H,31,32)/b10-8-,11-9-,18-16+,19-17-/t20-,21-,24+/m0/s1 |
| InChIKey | XXZKOKKTEVUKMG-WPDSWDMVSA-N |
| XLogP | 3.56 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|