C14H17FO4 — CID 166634377
6-[1-(3-fluoro-4-methoxyphenyl)ethenyl]-3,3-dimethyl-1,2,4-trioxane (PubChem CID 166634377) has the molecular formula C14H17FO4 and a molecular weight of 268.28 g/mol. Its IUPAC name is 6-[1-(3-fluoro-4-methoxyphenyl)ethenyl]-3,3-dimethyl-1,2,4-trioxane.
| Compound Name | 6-[1-(3-fluoro-4-methoxyphenyl)ethenyl]-3,3-dimethyl-1,2,4-trioxane |
|---|---|
| PubChem CID | 166634377 |
| Molecular Formula | C14H17FO4 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 6-[1-(3-fluoro-4-methoxyphenyl)ethenyl]-3,3-dimethyl-1,2,4-trioxane |
| SMILES | C=C(c1ccc(OC)c(F)c1)C1COC(C)(C)OO1 |
| InChI | InChI=1S/C14H17FO4/c1-9(13-8-17-14(2,3)19-18-13)10-5-6-12(16-4)11(15)7-10/h5-7,13H,1,8H2,2-4H3 |
| InChIKey | PPFMBCVLEMRQAD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|