C15H22O3 — CID 166634390
2-[(1R,3aR,7aS)-1,3a,4,7a-tetramethyl-6-oxo-1,2,3,7-tetrahydroinden-5-yl]acetic acid (PubChem CID 166634390) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-[(1R,3aR,7aS)-1,3a,4,7a-tetramethyl-6-oxo-1,2,3,7-tetrahydroinden-5-yl]acetic acid.
| Compound Name | 2-[(1R,3aR,7aS)-1,3a,4,7a-tetramethyl-6-oxo-1,2,3,7-tetrahydroinden-5-yl]acetic acid |
|---|---|
| PubChem CID | 166634390 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2-[(1R,3aR,7aS)-1,3a,4,7a-tetramethyl-6-oxo-1,2,3,7-tetrahydroinden-5-yl]acetic acid |
| SMILES | CC1=C(CC(=O)O)C(=O)C[C@@]2(C)[C@H](C)CC[C@@]12C |
| InChI | InChI=1S/C15H22O3/c1-9-5-6-14(3)10(2)11(7-13(17)18)12(16)8-15(9,14)4/h9H,5-8H2,1-4H3,(H,17,18)/t9-,14+,15+/m1/s1 |
| InChIKey | MVMJWXPJCZNGCX-NKZPBKNFSA-N |
| XLogP | 3.19 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |