About [(E)-[cyano-(6-nitro-1,3-benzoxazol-2-yl)methylidene]amino] N,N-dimethylcarbamate
[(E)-[cyano-(6-nitro-1,3-benzoxazol-2-yl)methylidene]amino] N,N-dimethylcarbamate (PubChem CID 166634462) has the molecular formula C12H9N5O5
and a molecular weight of 303.23 g/mol. Its IUPAC name is [(E)-[cyano-(6-nitro-1,3-benzoxazol-2-yl)methylidene]amino] N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | [(E)-[cyano-(6-nitro-1,3-benzoxazol-2-yl)methylidene]amino] N,N-dimethylcarbamate |
| PubChem CID | 166634462 |
| Molecular Formula | C12H9N5O5 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | [(E)-[cyano-(6-nitro-1,3-benzoxazol-2-yl)methylidene]amino] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)O/N=C(\C#N)c1nc2ccc([N+](=O)[O-])cc2o1 |
| InChI | InChI=1S/C12H9N5O5/c1-16(2)12(18)22-15-9(6-13)11-14-8-4-3-7(17(19)20)5-10(8)21-11/h3-5H,1-2H3/b15-9+ |
| InChIKey | WCNICJSGFKXBDT-OQLLNIDSSA-N |
| XLogP | 1.66 |
| TPSA | 134.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[cyano-(6-nitro-1,3-benzoxazol-2-yl)methylidene]amino] N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[cyano-(6-nitro-1,3-benzoxazol-2-yl)methylidene]amino] N,N-dimethylcarbamate?
The IUPAC name of [(E)-[cyano-(6-nitro-1,3-benzoxazol-2-yl)methylidene]amino] N,N-dimethylcarbamate (CID 166634462) is [(E)-[cyano-(6-nitro-1,3-benzoxazol-2-yl)methylidene]amino] N,N-dimethylcarbamate.
What is the SMILES notation for [(E)-[cyano-(6-nitro-1,3-benzoxazol-2-yl)methylidene]amino] N,N-dimethylcarbamate?
The canonical SMILES for [(E)-[cyano-(6-nitro-1,3-benzoxazol-2-yl)methylidene]amino] N,N-dimethylcarbamate is CN(C)C(=O)O/N=C(\C#N)c1nc2ccc([N+](=O)[O-])cc2o1.
What is the InChIKey of [(E)-[cyano-(6-nitro-1,3-benzoxazol-2-yl)methylidene]amino] N,N-dimethylcarbamate?
The InChIKey is WCNICJSGFKXBDT-OQLLNIDSSA-N. The full InChI is InChI=1S/C12H9N5O5/c1-16(2)12(18)22-15-9(6-13)11-14-8-4-3-7(17(19)20)5-10(8)21-11/h3-5H,1-2H3/b15-9+.
What are the key properties of [(E)-[cyano-(6-nitro-1,3-benzoxazol-2-yl)methylidene]amino] N,N-dimethylcarbamate?
[(E)-[cyano-(6-nitro-1,3-benzoxazol-2-yl)methylidene]amino] N,N-dimethylcarbamate has a molecular weight of 303.23 g/mol, XLogP of 1.66, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[cyano-(6-nitro-1,3-benzoxazol-2-yl)methylidene]amino] N,N-dimethylcarbamate is sourced from PubChem (CID 166634462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).