C44H62O6 — CID 166634465
8-[2-(1-adamantyl)acetyl]oxyoctyl (2Z,4Z,6S)-6-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]hepta-2,4-dienoate (PubChem CID 166634465) has the molecular formula C44H62O6 and a molecular weight of 686.97 g/mol. Its IUPAC name is 8-[2-(1-adamantyl)acetyl]oxyoctyl (2Z,4Z,6S)-6-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]hepta-2,4-dienoate.
| Compound Name | 8-[2-(1-adamantyl)acetyl]oxyoctyl (2Z,4Z,6S)-6-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]hepta-2,4-dienoate |
|---|---|
| PubChem CID | 166634465 |
| Molecular Formula | C44H62O6 |
| Molecular Weight | 686.97 g/mol |
| Exact Mass | 686.45 |
| IUPAC Name | 8-[2-(1-adamantyl)acetyl]oxyoctyl (2Z,4Z,6S)-6-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]hepta-2,4-dienoate |
| SMILES | CC1=CC(=O)[C@H]2/C(C=O)=C\C[C@H]3[C@@H]([C@@H](C)/C=C\C=C/C(=O)OCCCCCCCCOC(=O)CC45CC6CC(CC(C6)C4)C5)CC[C@]3(C)C[C@H]12 |
| InChI | InChI=1S/C44H62O6/c1-30(36-16-17-43(3)27-37-31(2)20-39(46)42(37)35(29-45)14-15-38(36)43)12-8-9-13-40(47)49-18-10-6-4-5-7-11-19-50-41(48)28-44-24-32-21-33(25-44)23-34(22-32)26-44/h8-9,12-14,20,29-30,32-34,36-38,42H,4-7,10-11,15-19,21-28H2,1-3H3/b12-8-,13-9-,35-14-/t30-,32?,33?,34?,36+,37+,38-,42-,43+,44?/m0/s1 |
| InChIKey | OAWRGNSCMWSPOO-CPLAFNSMSA-N |
| XLogP | 9.48 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.97 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|