C25H33ClN6O2S — CID 166634515
(NZ)-N-(1-amino-2,2-dimethylpropylidene)-5-(4-chlorophenyl)-N'-(diethylsulfamoyl)-4-phenyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 166634515) has the molecular formula C25H33ClN6O2S and a molecular weight of 517.10 g/mol. Its IUPAC name is (NZ)-N-(1-amino-2,2-dimethylpropylidene)-5-(4-chlorophenyl)-N'-(diethylsulfamoyl)-4-phenyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | (NZ)-N-(1-amino-2,2-dimethylpropylidene)-5-(4-chlorophenyl)-N'-(diethylsulfamoyl)-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 166634515 |
| Molecular Formula | C25H33ClN6O2S |
| Molecular Weight | 517.10 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | (NZ)-N-(1-amino-2,2-dimethylpropylidene)-5-(4-chlorophenyl)-N'-(diethylsulfamoyl)-4-phenyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CCN(CC)S(=O)(=O)/N=C(/N=C(\N)C(C)(C)C)N1CC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C25H33ClN6O2S/c1-6-31(7-2)35(33,34)30-24(28-23(27)25(3,4)5)32-17-21(18-11-9-8-10-12-18)22(29-32)19-13-15-20(26)16-14-19/h8-16,21H,6-7,17H2,1-5H3,(H2,27,28,30) |
| InChIKey | YVKYBZPIZUWLTD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 103.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.10 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|